Products 16423-68-0

CAS 16423-68-0 appears in our catalog under these names: Erythrosine, Erythrosine B Disodium Salt, >95% (HPLC), Erythrosine B Disodium Salt (Technical Grade), >95% (HPLC), Erythrosin B disodium, Erythrosin B disodium 100 µg/mL in Acetonitrile/Water. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 100mg, 10g, 1g, 250mg, 1ml, 50mg, 200mg.

Structural formula: {0} (CAS {1})

3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 16423-68-0) is a chemical compound with the molecular formula C20H8I4O5 and a molecular weight of 835.9 g/mol. IUPAC name: 3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: OALHHIHQOFIMEF-UHFFFAOYSA-N.

Identity
Molecular formulaC20H8I4O5
Molecular weight835.9 g/mol
IUPAC name3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one
InChIKeyOALHHIHQOFIMEF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C(=C4OC5=C(C(=C(C=C35)I)O)I)I)O)I

Computed by PubChem (NCBI)