CAS 159146-01-7 appears in our catalog under these names: Docosahexaenoic Acid-d5 Ethyl Ester, Docosahexaenoic Acid–d5 ethyl ester, Docosahexaenoic acid ethyl ester-d5-1. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 5mg, 100μg, 250μg, 500μg, 100 μg.
Ethyl (2E,4E,6E,8E,10E,12E)-2,3,4,5,6-pentadeuteriodocosa-2,4,6,8,10,12-hexaenoate (CAS 159146-01-7) is a chemical compound with the molecular formula C24H36O2 and a molecular weight of 361.6 g/mol. IUPAC name: ethyl (2E,4E,6E,8E,10E,12E)-2,3,4,5,6-pentadeuteriodocosa-2,4,6,8,10,12-hexaenoate. InChIKey: TYLNXKAVUJJPMU-MVCPWBNSSA-N.
| Molecular formula | C24H36O2 |
|---|---|
| Molecular weight | 361.6 g/mol |
| IUPAC name | ethyl (2E,4E,6E,8E,10E,12E)-2,3,4,5,6-pentadeuteriodocosa-2,4,6,8,10,12-hexaenoate |
| InChIKey | TYLNXKAVUJJPMU-MVCPWBNSSA-N |
| SMILES | [2H]\C(=C/C=C/C=C/C=C/CCCCCCCCC)\C(=C(/[2H])\C(=C(/[2H])\C(=O)OCC)\[2H])\[2H] |
Computed by PubChem (NCBI)