CAS 499985-15-8 appears in our catalog under these names: Estradiol Impurity 9, Estradiol Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(8R,9S,13S,14S,17S)-13-methyl-3,17-dipropoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (CAS 499985-15-8) is a chemical compound with the molecular formula C24H36O2 and a molecular weight of 356.5 g/mol. IUPAC name: (8R,9S,13S,14S,17S)-13-methyl-3,17-dipropoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene. InChIKey: LCDOMLMKJXRWSS-DJCPXJLLSA-N.
| Molecular formula | C24H36O2 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | (8R,9S,13S,14S,17S)-13-methyl-3,17-dipropoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| InChIKey | LCDOMLMKJXRWSS-DJCPXJLLSA-N |
| SMILES | CCCO[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)OCCC)C |
Computed by PubChem (NCBI)