Products 2692624-15-8
CAS 2692624-15-8 appears in our catalog under these names: Docosahexaenoic Acid ethyl ester–d5, Docosahexaenoic acid ethyl ester-d5, 99%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, 50μg, 500μg, 100 μg, 500 μg.
1,1,2,2,2-pentadeuterioethyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (CAS 2692624-15-8) is a chemical compound with the molecular formula C24H36O2 and a molecular weight of 361.6 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate. InChIKey: ITNKVODZACVXDS-HOUNFZJWSA-N.
| Molecular formula | C24H36O2 |
|---|---|
| Molecular weight | 361.6 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| InChIKey | ITNKVODZACVXDS-HOUNFZJWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
Computed by PubChem (NCBI)