CAS 159262-32-5 is the registry number for MPDC. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg, Get quote.
(1R,2S,5S,6S)-3-azabicyclo[3.1.0]hexane-2,6-dicarboxylic acid (CAS 159262-32-5) is a chemical compound with the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. IUPAC name: (1R,2S,5S,6S)-3-azabicyclo[3.1.0]hexane-2,6-dicarboxylic acid. InChIKey: UNNFLFDQCHJXPI-QTBDOELSSA-N.
| Molecular formula | C7H9NO4 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | (1R,2S,5S,6S)-3-azabicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| InChIKey | UNNFLFDQCHJXPI-QTBDOELSSA-N |
| SMILES | C1[C@H]2[C@H]([C@H]2C(=O)O)[C@H](N1)C(=O)O |
Computed by PubChem (NCBI)