CAS 159346-70-0 is the registry number for L-Cis-3,4-MPDC. Offered by: TRC. Available pack sizes: 100mg.
(1R,2S,5S,6R)-3-azabicyclo[3.1.0]hexane-2,6-dicarboxylic acid (CAS 159346-70-0) is a chemical compound with the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. IUPAC name: (1R,2S,5S,6R)-3-azabicyclo[3.1.0]hexane-2,6-dicarboxylic acid. InChIKey: UNNFLFDQCHJXPI-RSJOWCBRSA-N.
| Molecular formula | C7H9NO4 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | (1R,2S,5S,6R)-3-azabicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| InChIKey | UNNFLFDQCHJXPI-RSJOWCBRSA-N |
| SMILES | C1[C@H]2[C@H]([C@@H]2C(=O)O)[C@H](N1)C(=O)O |
Computed by PubChem (NCBI)