CAS 15930-59-3 appears in our catalog under these names: 3-Bromo-N,N-diethylbenzamide, 96%, 3-Bromo-N,N-diethylbenzamide 96%, 3-Bromo-N,N-diethylbenzamide, 96%, 96%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
3-bromo-N,N-diethylbenzamide (CAS 15930-59-3) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 3-bromo-N,N-diethylbenzamide. InChIKey: IRRXSHWDPARKJI-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 3-bromo-N,N-diethylbenzamide |
| InChIKey | IRRXSHWDPARKJI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)