CAS 1593050-95-3 appears in our catalog under these names: {1-oxaspiro(4.4)nonan-2-yl}methanesulfonyl chloride, 95%, {1-Oxaspiro(4.4)nonan-2-yl}methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-oxaspiro[4.4]nonan-2-ylmethanesulfonyl chloride (CAS 1593050-95-3) is a chemical compound with the molecular formula C9H15ClO3S and a molecular weight of 238.73 g/mol. IUPAC name: 1-oxaspiro[4.4]nonan-2-ylmethanesulfonyl chloride. InChIKey: UOTWCQDVUAUMMS-UHFFFAOYSA-N.
| Molecular formula | C9H15ClO3S |
|---|---|
| Molecular weight | 238.73 g/mol |
| IUPAC name | 1-oxaspiro[4.4]nonan-2-ylmethanesulfonyl chloride |
| InChIKey | UOTWCQDVUAUMMS-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CCC(O2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)