Products 2126177-51-1

CAS 2126177-51-1 appears in our catalog under these names: (5-Oxaspiro(3.5)nonan-6-yl)methanesulfonyl chloride, 98%, {5-Oxaspiro(3.5)nonan-6-yl}methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.

5-oxaspiro[3.5]nonan-6-ylmethanesulfonyl chloride (CAS 2126177-51-1) is a chemical compound with the molecular formula C9H15ClO3S and a molecular weight of 238.73 g/mol. IUPAC name: 5-oxaspiro[3.5]nonan-6-ylmethanesulfonyl chloride. InChIKey: GTMBOMHOOCFJKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15ClO3S
Molecular weight238.73 g/mol
IUPAC name5-oxaspiro[3.5]nonan-6-ylmethanesulfonyl chloride
InChIKeyGTMBOMHOOCFJKQ-UHFFFAOYSA-N
SMILESC1CC(OC2(C1)CCC2)CS(=O)(=O)Cl

Computed by PubChem (NCBI)