CAS 159330-31-1 appears in our catalog under these names: (R)-3-(tert-Butyldimethylsilyloxy) pyrrolidine, 98%, (R)-3-((tert-Butyldimethylsilyl)oxy)pyrrolidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl-dimethyl-[(3R)-pyrrolidin-3-yl]oxysilane (CAS 159330-31-1) is a chemical compound with the molecular formula C10H23NOSi and a molecular weight of 201.38 g/mol. IUPAC name: tert-butyl-dimethyl-[(3R)-pyrrolidin-3-yl]oxysilane. InChIKey: SDLGKSBUCUJCRU-SECBINFHSA-N.
| Molecular formula | C10H23NOSi |
|---|---|
| Molecular weight | 201.38 g/mol |
| IUPAC name | tert-butyl-dimethyl-[(3R)-pyrrolidin-3-yl]oxysilane |
| InChIKey | SDLGKSBUCUJCRU-SECBINFHSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCNC1 |
Computed by PubChem (NCBI)