CAS 1681019-72-6 appears in our catalog under these names: 3-{((tert-butyldimethylsilyl)oxy)methyl}azetidine, 95%, 3-{((tert-Butyldimethylsilyl)oxy)methyl}azetidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Azetidin-3-ylmethoxy-tert-butyl-dimethylsilane (CAS 1681019-72-6) is a chemical compound with the molecular formula C10H23NOSi and a molecular weight of 201.38 g/mol. IUPAC name: azetidin-3-ylmethoxy-tert-butyl-dimethylsilane. InChIKey: OTQLOBVJJPWUNE-UHFFFAOYSA-N.
| Molecular formula | C10H23NOSi |
|---|---|
| Molecular weight | 201.38 g/mol |
| IUPAC name | azetidin-3-ylmethoxy-tert-butyl-dimethylsilane |
| InChIKey | OTQLOBVJJPWUNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CNC1 |
Computed by PubChem (NCBI)