CAS 1593406-71-3 is the registry number for 2-Bromo-5,7,8-trifluoroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5,7,8-trifluoroquinoline (CAS 1593406-71-3) is a chemical compound with the molecular formula C9H3BrF3N and a molecular weight of 262.03 g/mol. IUPAC name: 2-bromo-5,7,8-trifluoroquinoline. InChIKey: DLJLAFOSQZXKNA-UHFFFAOYSA-N.
| Molecular formula | C9H3BrF3N |
|---|---|
| Molecular weight | 262.03 g/mol |
| IUPAC name | 2-bromo-5,7,8-trifluoroquinoline |
| InChIKey | DLJLAFOSQZXKNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CC(=C2F)F)F)Br |
Computed by PubChem (NCBI)