CAS 1601708-37-5 is the registry number for 2-Bromo-5,6,7-trifluoroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5,6,7-trifluoroquinoline (CAS 1601708-37-5) is a chemical compound with the molecular formula C9H3BrF3N and a molecular weight of 262.03 g/mol. IUPAC name: 2-bromo-5,6,7-trifluoroquinoline. InChIKey: UGDVXOWCMAFJND-UHFFFAOYSA-N.
| Molecular formula | C9H3BrF3N |
|---|---|
| Molecular weight | 262.03 g/mol |
| IUPAC name | 2-bromo-5,6,7-trifluoroquinoline |
| InChIKey | UGDVXOWCMAFJND-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=CC(=C(C(=C21)F)F)F)Br |
Computed by PubChem (NCBI)