Products 159345-13-8

CAS 159345-13-8 is the registry number for Diethyl 2–(((benzyloxy)carbonyl)amino)–2–cyanosuccinate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 2-cyano-2-(phenylmethoxycarbonylamino)butanedioate (CAS 159345-13-8) is a chemical compound with the molecular formula C17H20N2O6 and a molecular weight of 348.3 g/mol. IUPAC name: diethyl 2-cyano-2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: IOBJZPRYXPGLCE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20N2O6
Molecular weight348.3 g/mol
IUPAC namediethyl 2-cyano-2-(phenylmethoxycarbonylamino)butanedioate
InChIKeyIOBJZPRYXPGLCE-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C#N)(C(=O)OCC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)