CAS 3496-11-5 appears in our catalog under these names: Z–Val–OSu, Z-L-Val-OSu, N-Benzyloxycarbonyl-L-valine N-succinimidyl ester, 98% , N-Carbobenzoxy-L-valine Succinimidyl Ester, >98.0%(HPLC), Z-L-Valine N-hydroxysuccinimide ester. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 100g, 25g, 500g, 5g, 0,5kg, 0,25kg, 1kg, 5kg.
(2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (CAS 3496-11-5) is a chemical compound with the molecular formula C17H20N2O6 and a molecular weight of 348.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: MFAOBGXYLNLLJE-HNNXBMFYSA-N.
| Molecular formula | C17H20N2O6 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | MFAOBGXYLNLLJE-HNNXBMFYSA-N |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)