Products 159406-49-2
CAS 159406-49-2 is the registry number for (1S,4S)-2-Oxa-5-azabicyclo[2.2.1]heptan-3-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one;hydrochloride (CAS 159406-49-2) is a chemical compound with the molecular formula C5H8ClNO2 and a molecular weight of 149.57 g/mol. IUPAC name: (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one;hydrochloride. InChIKey: GBMCZIUKNIOICE-MMALYQPHSA-N.
| Molecular formula | C5H8ClNO2 |
|---|---|
| Molecular weight | 149.57 g/mol |
| IUPAC name | (1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one;hydrochloride |
| InChIKey | GBMCZIUKNIOICE-MMALYQPHSA-N |
| SMILES | C1[C@H]2CN[C@@H]1C(=O)O2.Cl |
Computed by PubChem (NCBI)