Products 16214-29-2
CAS 16214-29-2 appears in our catalog under these names: Vildagliptin Impurity 71, Vildagliptin Impurity 50. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,4R)-4-chloropyrrolidine-2-carboxylic acid (CAS 16214-29-2) is a chemical compound with the molecular formula C5H8ClNO2 and a molecular weight of 149.57 g/mol. IUPAC name: (2S,4R)-4-chloropyrrolidine-2-carboxylic acid. InChIKey: UYZNMRJCNSDDFV-DMTCNVIQSA-N.
| Molecular formula | C5H8ClNO2 |
|---|---|
| Molecular weight | 149.57 g/mol |
| IUPAC name | (2S,4R)-4-chloropyrrolidine-2-carboxylic acid |
| InChIKey | UYZNMRJCNSDDFV-DMTCNVIQSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)Cl |
Computed by PubChem (NCBI)