Products 159407-40-6
CAS 159407-40-6 is the registry number for (2S,3S)-2-Azido-3-methylpentanoic Acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S,3S)-2-azido-3-methylpentanoic acid (CAS 159407-40-6) is a chemical compound with the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. IUPAC name: (2S,3S)-2-azido-3-methylpentanoic acid. InChIKey: QRVNRYQHRHOJFD-WHFBIAKZSA-N.
| Molecular formula | C6H11N3O2 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | (2S,3S)-2-azido-3-methylpentanoic acid |
| InChIKey | QRVNRYQHRHOJFD-WHFBIAKZSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)