CAS 159424-05-2 appears in our catalog under these names: 1-(4-tert-Butylphenyl)prop-2-yn-1-one, 95%, 1-(4-tert-Butylphenyl)prop-2-yn-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 500mg, 250mg.
1-(4-tert-butylphenyl)prop-2-yn-1-one (CAS 159424-05-2) is a chemical compound with the molecular formula C13H14O and a molecular weight of 186.25 g/mol. IUPAC name: 1-(4-tert-butylphenyl)prop-2-yn-1-one. InChIKey: SFRUVSDHWKYMHZ-UHFFFAOYSA-N.
| Molecular formula | C13H14O |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)prop-2-yn-1-one |
| InChIKey | SFRUVSDHWKYMHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)C#C |
Computed by PubChem (NCBI)