CAS 159505-85-8 is the registry number for Fmoc-D-Phe-OPfp, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate (CAS 159505-85-8) is a chemical compound with the molecular formula C30H20F5NO4 and a molecular weight of 553.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate. InChIKey: WKHPSOMXNCTXPK-JOCHJYFZSA-N.
| Molecular formula | C30H20F5NO4 |
|---|---|
| Molecular weight | 553.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
| InChIKey | WKHPSOMXNCTXPK-JOCHJYFZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)