CAS 86060-92-6 appears in our catalog under these names: Fmoc–Phe–OPfp, Fmoc-Phe-OPfp 96%, Fmoc-Phe-OPfp, 96%, 96%, fmoc-phe-opfp, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
(2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate (CAS 86060-92-6) is a chemical compound with the molecular formula C30H20F5NO4 and a molecular weight of 553.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate. InChIKey: WKHPSOMXNCTXPK-QFIPXVFZSA-N.
| Molecular formula | C30H20F5NO4 |
|---|---|
| Molecular weight | 553.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoate |
| InChIKey | WKHPSOMXNCTXPK-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)