CAS 15952-70-2 is the registry number for 1,3-Dichloro-2,4-difluoro-5-nitrobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1,3-dichloro-2,4-difluoro-5-nitrobenzene (CAS 15952-70-2) is a chemical compound with the molecular formula C6HCl2F2NO2 and a molecular weight of 227.98 g/mol. IUPAC name: 1,3-dichloro-2,4-difluoro-5-nitrobenzene. InChIKey: OWALCRQILZGQDH-UHFFFAOYSA-N.
| Molecular formula | C6HCl2F2NO2 |
|---|---|
| Molecular weight | 227.98 g/mol |
| IUPAC name | 1,3-dichloro-2,4-difluoro-5-nitrobenzene |
| InChIKey | OWALCRQILZGQDH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)