CAS 774-19-6 is the registry number for 2,4-Dichloro-3,5-difluoronitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,4-dichloro-1,3-difluoro-5-nitrobenzene (CAS 774-19-6) is a chemical compound with the molecular formula C6HCl2F2NO2 and a molecular weight of 227.98 g/mol. IUPAC name: 2,4-dichloro-1,3-difluoro-5-nitrobenzene. InChIKey: JMGWWGJSSUQAFX-UHFFFAOYSA-N.
| Molecular formula | C6HCl2F2NO2 |
|---|---|
| Molecular weight | 227.98 g/mol |
| IUPAC name | 2,4-dichloro-1,3-difluoro-5-nitrobenzene |
| InChIKey | JMGWWGJSSUQAFX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Cl)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)