CAS 15965-60-3 appears in our catalog under these names: 2-Chloro-1,5-dimethyl-1H-benzo(d)imidazole, 95+%, 2-Chloro-1,5-dimethyl-1H-benzo(D)imidazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-1,5-dimethylbenzimidazole (CAS 15965-60-3) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 180.63 g/mol. IUPAC name: 2-chloro-1,5-dimethylbenzimidazole. InChIKey: ZFNQWUCRBLFKDP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 2-chloro-1,5-dimethylbenzimidazole |
| InChIKey | ZFNQWUCRBLFKDP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=N2)Cl)C |
Computed by PubChem (NCBI)