CAS 1596840-04-8 is the registry number for rac-(2R,5S)-5-(Pyrrolidine-1-carbonyl)oxolane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S,5R)-5-(pyrrolidine-1-carbonyl)oxolane-2-carboxylic acid (CAS 1596840-04-8) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: (2S,5R)-5-(pyrrolidine-1-carbonyl)oxolane-2-carboxylic acid. InChIKey: FKCXZHQBMNYWSB-SFYZADRCSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | (2S,5R)-5-(pyrrolidine-1-carbonyl)oxolane-2-carboxylic acid |
| InChIKey | FKCXZHQBMNYWSB-SFYZADRCSA-N |
| SMILES | C1CCN(C1)C(=O)[C@H]2CC[C@H](O2)C(=O)O |
Computed by PubChem (NCBI)