CAS 1597298-23-1 is the registry number for (5-Cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonyl chloride (CAS 1597298-23-1) is a chemical compound with the molecular formula C6H7ClN2O3S and a molecular weight of 222.65 g/mol. IUPAC name: (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonyl chloride. InChIKey: GHHCOELCLGQPSC-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O3S |
|---|---|
| Molecular weight | 222.65 g/mol |
| IUPAC name | (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanesulfonyl chloride |
| InChIKey | GHHCOELCLGQPSC-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=NO2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)