CAS 41606-65-9 appears in our catalog under these names: 4-Amino-2-chloro-5-hydroxybenzensulfonamide, 95%, 2-Aminophenol-4-chloro-5-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 2g, 10g.
4-amino-2-chloro-5-hydroxybenzenesulfonamide (CAS 41606-65-9) is a chemical compound with the molecular formula C6H7ClN2O3S and a molecular weight of 222.65 g/mol. IUPAC name: 4-amino-2-chloro-5-hydroxybenzenesulfonamide. InChIKey: WUDOEWHXJCBYJH-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O3S |
|---|---|
| Molecular weight | 222.65 g/mol |
| IUPAC name | 4-amino-2-chloro-5-hydroxybenzenesulfonamide |
| InChIKey | WUDOEWHXJCBYJH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)S(=O)(=O)N)O)N |
Computed by PubChem (NCBI)