CAS 1597410-40-6 is the registry number for (E)-4-(4-Benzoyloxyphenyl)-but-3-en-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
[4-[(E)-3-oxobut-1-enyl]phenyl] benzoate (CAS 1597410-40-6) is a chemical compound with the molecular formula C17H14O3 and a molecular weight of 266.29 g/mol. IUPAC name: [4-[(E)-3-oxobut-1-enyl]phenyl] benzoate. InChIKey: KPBZHSBWLSAUSM-BQYQJAHWSA-N.
| Molecular formula | C17H14O3 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | [4-[(E)-3-oxobut-1-enyl]phenyl] benzoate |
| InChIKey | KPBZHSBWLSAUSM-BQYQJAHWSA-N |
| SMILES | CC(=O)/C=C/C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)