CAS 1597427-15-0 is the registry number for Rel-methyl 4-((1R,2R)-2-(tert-butoxycarbonyl)cyclopropyl)benzoate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-[(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]benzoate (CAS 1597427-15-0) is a chemical compound with the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. IUPAC name: methyl 4-[(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]benzoate. InChIKey: DPWRROUPJKRSOY-QWHCGFSZSA-N.
| Molecular formula | C16H20O4 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | methyl 4-[(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]benzoate |
| InChIKey | DPWRROUPJKRSOY-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@H]1C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)