CAS 168169-98-0 appears in our catalog under these names: (E)-3-(3-(Cyclopentyloxy)-4-methoxyphenyl)-2-methylacrylic acid, 95%, (E)–3–(3–(cyclopentyloxy)–4–methoxyphenyl)–2–methylacrylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(E)-3-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylprop-2-enoic acid (CAS 168169-98-0) is a chemical compound with the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. IUPAC name: (E)-3-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylprop-2-enoic acid. InChIKey: TWMCIJDQYXIRRL-PKNBQFBNSA-N.
| Molecular formula | C16H20O4 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | (E)-3-(3-cyclopentyloxy-4-methoxyphenyl)-2-methylprop-2-enoic acid |
| InChIKey | TWMCIJDQYXIRRL-PKNBQFBNSA-N |
| SMILES | C/C(=C\C1=CC(=C(C=C1)OC)OC2CCCC2)/C(=O)O |
Computed by PubChem (NCBI)