CAS 159753-14-7 is the registry number for 1-(2-Methoxy-5-nitrophenyl)thiourea, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
(2-methoxy-5-nitrophenyl)thiourea (CAS 159753-14-7) is a chemical compound with the molecular formula C8H9N3O3S and a molecular weight of 227.24 g/mol. IUPAC name: (2-methoxy-5-nitrophenyl)thiourea. InChIKey: XIOYSXKDIDOGPF-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | (2-methoxy-5-nitrophenyl)thiourea |
| InChIKey | XIOYSXKDIDOGPF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])NC(=S)N |
Computed by PubChem (NCBI)