Products 1598044-05-3
CAS 1598044-05-3 is the registry number for Cyclopropyl(2,6-dichlorophenyl)methanone. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cyclopropyl-(2,6-dichlorophenyl)methanone (CAS 1598044-05-3) is a chemical compound with the molecular formula C10H8Cl2O and a molecular weight of 215.07 g/mol. IUPAC name: cyclopropyl-(2,6-dichlorophenyl)methanone. InChIKey: DWAMSGJRCLTENE-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O |
|---|---|
| Molecular weight | 215.07 g/mol |
| IUPAC name | cyclopropyl-(2,6-dichlorophenyl)methanone |
| InChIKey | DWAMSGJRCLTENE-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)