CAS 74546-02-4 is the registry number for 4-(3,4-Dichlorophenyl)but-3-en-2-one, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(E)-4-(3,4-dichlorophenyl)but-3-en-2-one (CAS 74546-02-4) is a chemical compound with the molecular formula C10H8Cl2O and a molecular weight of 215.07 g/mol. IUPAC name: (E)-4-(3,4-dichlorophenyl)but-3-en-2-one. InChIKey: HSKXQSBYMAGOIH-NSCUHMNNSA-N.
| Molecular formula | C10H8Cl2O |
|---|---|
| Molecular weight | 215.07 g/mol |
| IUPAC name | (E)-4-(3,4-dichlorophenyl)but-3-en-2-one |
| InChIKey | HSKXQSBYMAGOIH-NSCUHMNNSA-N |
| SMILES | CC(=O)/C=C/C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)