CAS 15982-33-9 appears in our catalog under these names: Rel-(1R,2S)-2-carbamoylcyclopropane-1-carboxylic acid, 97%, rac-(1R,2S)-2-Carbamoylcyclopropane-1-carboxylic acid, RAC-(1R,2S)-2-CARBAMOYLCYCLOPROPANE-1-CARBOXYLIC ACID, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 5g, 2,5g, 250mg, 100mg, 500mg, 1g.
Cis-(1R,2S)-2-carbamoylcyclopropane-1-carboxylic acid (CAS 15982-33-9) is a chemical compound with the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. IUPAC name: cis-(1R,2S)-2-carbamoylcyclopropane-1-carboxylic acid. InChIKey: WYCFAOQMGVSOAG-STHAYSLISA-N.
| Molecular formula | C5H7NO3 |
|---|---|
| Molecular weight | 129.11 g/mol |
| IUPAC name | cis-(1R,2S)-2-carbamoylcyclopropane-1-carboxylic acid |
| InChIKey | WYCFAOQMGVSOAG-STHAYSLISA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)O)C(=O)N |
Computed by PubChem (NCBI)