Products 84585-80-8

CAS 84585-80-8 is the registry number for trans-2-Carbamoylcyclopropane-1-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Trans-(1R,2R)-2-carbamoylcyclopropane-1-carboxylic acid (CAS 84585-80-8) is a chemical compound with the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. IUPAC name: trans-(1R,2R)-2-carbamoylcyclopropane-1-carboxylic acid. InChIKey: WYCFAOQMGVSOAG-PWNYCUMCSA-N.

Identity
Molecular formulaC5H7NO3
Molecular weight129.11 g/mol
IUPAC nametrans-(1R,2R)-2-carbamoylcyclopropane-1-carboxylic acid
InChIKeyWYCFAOQMGVSOAG-PWNYCUMCSA-N
SMILESC1[C@H]([C@@H]1C(=O)O)C(=O)N

Computed by PubChem (NCBI)