CAS 84585-80-8 is the registry number for trans-2-Carbamoylcyclopropane-1-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Trans-(1R,2R)-2-carbamoylcyclopropane-1-carboxylic acid (CAS 84585-80-8) is a chemical compound with the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. IUPAC name: trans-(1R,2R)-2-carbamoylcyclopropane-1-carboxylic acid. InChIKey: WYCFAOQMGVSOAG-PWNYCUMCSA-N.
| Molecular formula | C5H7NO3 |
|---|---|
| Molecular weight | 129.11 g/mol |
| IUPAC name | trans-(1R,2R)-2-carbamoylcyclopropane-1-carboxylic acid |
| InChIKey | WYCFAOQMGVSOAG-PWNYCUMCSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C(=O)N |
Computed by PubChem (NCBI)