CAS 159837-99-7 appears in our catalog under these names: L-Lyxonic acid potassium salt, 95%, L-Lyxonic acid potassium, L-Lyxonic acid potassium min.98%. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2g.
Potassium (2R,3R,4S)-2,3,4,5-tetrahydroxypentanoate (CAS 159837-99-7) is a chemical compound with the molecular formula C5H9KO6 and a molecular weight of 204.22 g/mol. IUPAC name: potassium (2R,3R,4S)-2,3,4,5-tetrahydroxypentanoate. InChIKey: HSMKJRYJAZFMNP-OCSZXWPNSA-M.
| Molecular formula | C5H9KO6 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | potassium (2R,3R,4S)-2,3,4,5-tetrahydroxypentanoate |
| InChIKey | HSMKJRYJAZFMNP-OCSZXWPNSA-M |
| SMILES | C([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O.[K+] |
Computed by PubChem (NCBI)