CAS 78138-87-1 appears in our catalog under these names: D-Lyxonic acid potassium salt, 95%, D-Lyxonic Acid, Potassium Salt, >95% (HPLC), Potassium D–lyxonate, D-Lyxonic acid potassium, D-Lyxonic acid (potassium). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 2,5g, 0,5g, 2g, 5g, 250 mg, 100 mg.
Potassium (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoate (CAS 78138-87-1) is a chemical compound with the molecular formula C5H9KO6 and a molecular weight of 204.22 g/mol. IUPAC name: potassium (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoate. InChIKey: HSMKJRYJAZFMNP-VGFCZBDGSA-M.
| Molecular formula | C5H9KO6 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | potassium (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoate |
| InChIKey | HSMKJRYJAZFMNP-VGFCZBDGSA-M |
| SMILES | C([C@H]([C@@H]([C@@H](C(=O)[O-])O)O)O)O.[K+] |
Computed by PubChem (NCBI)