Products 159912-58-0
CAS 159912-58-0 appears in our catalog under these names: Sabcomeline hydrochloride, Sabcomeline hydrochloride, Sabcomeline (hydrochloride), 99.81%, Sabcomeline (hydrochloride), 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 10mg, 5mg, 50 mg, 100 mg, 5 mg, 10 mg, 25 mg.
(3Z,3R)-N-methoxy-1-azabicyclo[2.2.2]octane-3-carboximidoyl cyanide;hydrochloride (CAS 159912-58-0) is a chemical compound with the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. IUPAC name: (3Z,3R)-N-methoxy-1-azabicyclo[2.2.2]octane-3-carboximidoyl cyanide;hydrochloride. InChIKey: INJWRVWKJFJRFO-SCRZZQONSA-N.
| Molecular formula | C10H16ClN3O |
|---|---|
| Molecular weight | 229.71 g/mol |
| IUPAC name | (3Z,3R)-N-methoxy-1-azabicyclo[2.2.2]octane-3-carboximidoyl cyanide;hydrochloride |
| InChIKey | INJWRVWKJFJRFO-SCRZZQONSA-N |
| SMILES | CO/N=C(\C#N)/[C@H]1CN2CCC1CC2.Cl |
Computed by PubChem (NCBI)