CAS 15996-16-4 appears in our catalog under these names: Cycloserine Impurity 8, (3S,6R)-3,6-Bis(hydroxymethyl)piperazine-2,5-dione, rac-(3S,6R)-3,6-Bis(hydroxymethyl)piperazine-2,5-dione. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 0,5g, 50mg.
(3R,6S)-3,6-bis(hydroxymethyl)piperazine-2,5-dione (CAS 15996-16-4) is a chemical compound with the molecular formula C6H10N2O4 and a molecular weight of 174.15 g/mol. IUPAC name: (3R,6S)-3,6-bis(hydroxymethyl)piperazine-2,5-dione. InChIKey: SUWGHSHLNOADHI-ZXZARUISSA-N.
| Molecular formula | C6H10N2O4 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | (3R,6S)-3,6-bis(hydroxymethyl)piperazine-2,5-dione |
| InChIKey | SUWGHSHLNOADHI-ZXZARUISSA-N |
| SMILES | C([C@@H]1C(=O)N[C@H](C(=O)N1)CO)O |
Computed by PubChem (NCBI)