CAS 23409-30-5 appears in our catalog under these names: Cyclo(–Ser–Ser), Cyclo(-ser-ser), 95%, Cyclo(L-Ser-L-Ser), cis-3,6-Bis(hydroxymethyl)piperazine-2,5-dione, 97%, 97%, Cyclo(L-Ser-L-Ser), 97%. Offered by: GLPBio, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 1000mg, 2000mg, 50mg.
(3S,6S)-3,6-bis(hydroxymethyl)piperazine-2,5-dione (CAS 23409-30-5) is a chemical compound with the molecular formula C6H10N2O4 and a molecular weight of 174.15 g/mol. IUPAC name: (3S,6S)-3,6-bis(hydroxymethyl)piperazine-2,5-dione. InChIKey: SUWGHSHLNOADHI-IMJSIDKUSA-N.
| Molecular formula | C6H10N2O4 |
|---|---|
| Molecular weight | 174.15 g/mol |
| IUPAC name | (3S,6S)-3,6-bis(hydroxymethyl)piperazine-2,5-dione |
| InChIKey | SUWGHSHLNOADHI-IMJSIDKUSA-N |
| SMILES | C([C@H]1C(=O)N[C@H](C(=O)N1)CO)O |
Computed by PubChem (NCBI)