Products 160033-81-8
CAS 160033-81-8 is the registry number for L-Alanine-13C,d1, 98.0%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 50 mg, 25 mg, 100 mg.
(2S)-2-amino-2-deuterio(313C)propanoic acid (CAS 160033-81-8) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 91.09 g/mol. IUPAC name: (2S)-2-amino-2-deuterio(313C)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-LFEAEDJLSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 91.09 g/mol |
| IUPAC name | (2S)-2-amino-2-deuterio(313C)propanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-LFEAEDJLSA-N |
| SMILES | [2H][C@]([13CH3])(C(=O)O)N |
Computed by PubChem (NCBI)