CAS 160052-20-0 is the registry number for 3-((tert-Butyldimethylsilyl)oxy)-2,2-difluoropropan-1-ol, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol (CAS 160052-20-0) is a chemical compound with the molecular formula C9H20F2O2Si and a molecular weight of 226.34 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol. InChIKey: UUUIKBCVTNOIGV-UHFFFAOYSA-N.
| Molecular formula | C9H20F2O2Si |
|---|---|
| Molecular weight | 226.34 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxy-2,2-difluoropropan-1-ol |
| InChIKey | UUUIKBCVTNOIGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO)(F)F |
Computed by PubChem (NCBI)