CAS 2059154-95-7 is the registry number for (R)-3-((tert-Butyldimethylsilyl)oxy)-1,1-difluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol (CAS 2059154-95-7) is a chemical compound with the molecular formula C9H20F2O2Si and a molecular weight of 226.34 g/mol. IUPAC name: (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol. InChIKey: RHNLFWVISDYSMV-SSDOTTSWSA-N.
| Molecular formula | C9H20F2O2Si |
|---|---|
| Molecular weight | 226.34 g/mol |
| IUPAC name | (2R)-3-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoropropan-2-ol |
| InChIKey | RHNLFWVISDYSMV-SSDOTTSWSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](C(F)F)O |
Computed by PubChem (NCBI)