CAS 1600866-95-2 is the registry number for tert-Butyl (3-amino-2,2-dimethyl-3-thioxopropyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-amino-2,2-dimethyl-3-sulfanylidenepropyl)carbamate (CAS 1600866-95-2) is a chemical compound with the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. IUPAC name: tert-butyl N-(3-amino-2,2-dimethyl-3-sulfanylidenepropyl)carbamate. InChIKey: XUGCZFNAZYCYGL-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O2S |
|---|---|
| Molecular weight | 232.35 g/mol |
| IUPAC name | tert-butyl N-(3-amino-2,2-dimethyl-3-sulfanylidenepropyl)carbamate |
| InChIKey | XUGCZFNAZYCYGL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)C(=S)N |
Computed by PubChem (NCBI)