Products 1602360-37-1

CAS 1602360-37-1 is the registry number for 4-[3-(Dimethylamino)propyl]thiomorpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[3-(dimethylamino)propyl]thiomorpholine-3-carboxylic acid (CAS 1602360-37-1) is a chemical compound with the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. IUPAC name: 4-[3-(dimethylamino)propyl]thiomorpholine-3-carboxylic acid. InChIKey: CUZRLUMESUSJRS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20N2O2S
Molecular weight232.35 g/mol
IUPAC name4-[3-(dimethylamino)propyl]thiomorpholine-3-carboxylic acid
InChIKeyCUZRLUMESUSJRS-UHFFFAOYSA-N
SMILESCN(C)CCCN1CCSCC1C(=O)O

Computed by PubChem (NCBI)