CAS 1600940-76-8 is the registry number for 2-Methanesulfonamido-3,3-dimethylbutanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(methanesulfonamido)-3,3-dimethylbutanoic acid (CAS 1600940-76-8) is a chemical compound with the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. IUPAC name: 2-(methanesulfonamido)-3,3-dimethylbutanoic acid. InChIKey: FDBMNHWDNXNFMF-UHFFFAOYSA-N.
| Molecular formula | C7H15NO4S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | 2-(methanesulfonamido)-3,3-dimethylbutanoic acid |
| InChIKey | FDBMNHWDNXNFMF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NS(=O)(=O)C |
Computed by PubChem (NCBI)