Products 894351-83-8

CAS 894351-83-8 is the registry number for N-Methyl-N-(methylsulfonyl)-carbamic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 500mg, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-methyl-N-methylsulfonylcarbamate (CAS 894351-83-8) is a chemical compound with the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. IUPAC name: tert-butyl N-methyl-N-methylsulfonylcarbamate. InChIKey: GBCCMPHACGIDKA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15NO4S
Molecular weight209.27 g/mol
IUPAC nametert-butyl N-methyl-N-methylsulfonylcarbamate
InChIKeyGBCCMPHACGIDKA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)S(=O)(=O)C

Computed by PubChem (NCBI)