Products 1601-98-5
CAS 1601-98-5 appears in our catalog under these names: 1,2-Bis(4-bromophenyl)diazene, 98%, 1,2–Bis(4–bromophenyl)diazene, 1,2-Bis(4-bromophenyl)diazene 95%, Diazene, 1,2-bis(4-bromophenyl)-, 97%, 97%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
Bis(4-bromophenyl)diazene (CAS 1601-98-5) is a chemical compound with the molecular formula C12H8Br2N2 and a molecular weight of 340.01 g/mol. IUPAC name: bis(4-bromophenyl)diazene. InChIKey: LTPLLZWVPBTAMH-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2N2 |
|---|---|
| Molecular weight | 340.01 g/mol |
| IUPAC name | bis(4-bromophenyl)diazene |
| InChIKey | LTPLLZWVPBTAMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)