CAS 2528-87-2 appears in our catalog under these names: 1–(2,5–Dibromophenyl)–2–phenyldiazene, 1-(2,5-Dibromophenyl)-2-phenyldiazene, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 5g, 100mg, 1g.
(2,5-dibromophenyl)-phenyldiazene (CAS 2528-87-2) is a chemical compound with the molecular formula C12H8Br2N2 and a molecular weight of 340.01 g/mol. IUPAC name: (2,5-dibromophenyl)-phenyldiazene. InChIKey: QQKXXFISWWAQMI-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2N2 |
|---|---|
| Molecular weight | 340.01 g/mol |
| IUPAC name | (2,5-dibromophenyl)-phenyldiazene |
| InChIKey | QQKXXFISWWAQMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)