CAS 1601138-09-3 is the registry number for 8-(2,2,2-Trifluoroethyl)-9h-purin-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-(2,2,2-trifluoroethyl)-7H-purin-6-amine (CAS 1601138-09-3) is a chemical compound with the molecular formula C7H6F3N5 and a molecular weight of 217.15 g/mol. IUPAC name: 8-(2,2,2-trifluoroethyl)-7H-purin-6-amine. InChIKey: ZULXGRLCXKUHTK-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N5 |
|---|---|
| Molecular weight | 217.15 g/mol |
| IUPAC name | 8-(2,2,2-trifluoroethyl)-7H-purin-6-amine |
| InChIKey | ZULXGRLCXKUHTK-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N=C(N2)CC(F)(F)F)N |
Computed by PubChem (NCBI)